C34H46 — CID 87109748
1-cyclopenta-1,3-dien-1-yl-2,7-diethyl-2,3,4,5-tetrapropylfluorene (PubChem CID 87109748) has the molecular formula C34H46 and a molecular weight of 454.74 g/mol. Its IUPAC name is 1-cyclopenta-1,3-dien-1-yl-2,7-diethyl-2,3,4,5-tetrapropylfluorene.
| Compound Name | 1-cyclopenta-1,3-dien-1-yl-2,7-diethyl-2,3,4,5-tetrapropylfluorene |
|---|---|
| PubChem CID | 87109748 |
| Molecular Formula | C34H46 |
| Molecular Weight | 454.74 g/mol |
| Exact Mass | 454.36 |
| IUPAC Name | 1-cyclopenta-1,3-dien-1-yl-2,7-diethyl-2,3,4,5-tetrapropylfluorene |
| SMILES | CCCC1=C(CCC)C(CC)(CCC)C(C2=CC=CC2)=C2C=c3cc(CC)cc(CCC)c3=C21 |
| InChI | InChI=1S/C34H46/c1-7-15-26-21-24(11-5)22-27-23-29-32(31(26)27)28(16-8-2)30(17-9-3)34(12-6,20-10-4)33(29)25-18-13-14-19-25/h13-14,18,21-23H,7-12,15-17,19-20H2,1-6H3 |
| InChIKey | ZWJZGOSWEKLUIW-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.74 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |