C30H34 — CID 140879728
16-tert-butyl-9-(3-methylcyclopenta-1,3-dien-1-yl)-5-propyltetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),2,4,8,10,14,16-heptaene (PubChem CID 140879728) has the molecular formula C30H34 and a molecular weight of 394.60 g/mol. Its IUPAC name is 16-tert-butyl-9-(3-methylcyclopenta-1,3-dien-1-yl)-5-propyltetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),2,4,8,10,14,16-heptaene.
| Compound Name | 16-tert-butyl-9-(3-methylcyclopenta-1,3-dien-1-yl)-5-propyltetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),2,4,8,10,14,16-heptaene |
|---|---|
| PubChem CID | 140879728 |
| Molecular Formula | C30H34 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 16-tert-butyl-9-(3-methylcyclopenta-1,3-dien-1-yl)-5-propyltetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),2,4,8,10,14,16-heptaene |
| SMILES | CCCC1=CC=C2c3cc(C(C)(C)C)ccc3C3C=CC(C4=CC(C)=CC4)=C3CC12 |
| InChI | InChI=1S/C30H34/c1-6-7-20-10-12-26-27(20)18-29-23(21-9-8-19(2)16-21)14-15-25(29)24-13-11-22(17-28(24)26)30(3,4)5/h8,10-17,25,27H,6-7,9,18H2,1-5H3 |
| InChIKey | AHYOCPCPKBTVIG-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |