C38H40 — CID 91230153
12-[5-tert-butyl-2-(4-tert-butylcyclohexa-2,4-dien-1-yl)phenyl]-4a,12a-dihydrochrysene (PubChem CID 91230153) has the molecular formula C38H40 and a molecular weight of 496.74 g/mol. Its IUPAC name is 12-[5-tert-butyl-2-(4-tert-butylcyclohexa-2,4-dien-1-yl)phenyl]-4a,12a-dihydrochrysene.
| Compound Name | 12-[5-tert-butyl-2-(4-tert-butylcyclohexa-2,4-dien-1-yl)phenyl]-4a,12a-dihydrochrysene |
|---|---|
| PubChem CID | 91230153 |
| Molecular Formula | C38H40 |
| Molecular Weight | 496.74 g/mol |
| Exact Mass | 496.31 |
| IUPAC Name | 12-[5-tert-butyl-2-(4-tert-butylcyclohexa-2,4-dien-1-yl)phenyl]-4a,12a-dihydrochrysene |
| SMILES | CC(C)(C)C1=CCC(c2ccc(C(C)(C)C)cc2C2=Cc3c(ccc4ccccc34)C3C=CC=CC23)C=C1 |
| InChI | InChI=1S/C38H40/c1-37(2,3)27-18-15-26(16-19-27)30-22-20-28(38(4,5)6)23-34(30)36-24-35-29-12-8-7-11-25(29)17-21-33(35)31-13-9-10-14-32(31)36/h7-15,17-24,26,31-32H,16H2,1-6H3 |
| InChIKey | YTUOSROXBSVXRC-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.74 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|