C23H23F4N3O3 — CID 19035214
7-(4-amino-7-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-1-cyclopropyl-5-fluoro-4-oxo-8-(trifluoromethyl)quinoline-3-carboxylic acid (PubChem CID 19035214) has the molecular formula C23H23F4N3O3 and a molecular weight of 465.45 g/mol. Its IUPAC name is 7-(4-amino-7-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-1-cyclopropyl-5-fluoro-4-oxo-8-(trifluoromethyl)quinoline-3-carboxylic acid.
| Compound Name | 7-(4-amino-7-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-1-cyclopropyl-5-fluoro-4-oxo-8-(trifluoromethyl)quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 19035214 |
| Molecular Formula | C23H23F4N3O3 |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 7-(4-amino-7-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-1-cyclopropyl-5-fluoro-4-oxo-8-(trifluoromethyl)quinoline-3-carboxylic acid |
| SMILES | CC1C=CC(N)C2CN(c3cc(F)c4c(=O)c(C(=O)O)cn(C5CC5)c4c3C(F)(F)F)CC12 |
| InChI | InChI=1S/C23H23F4N3O3/c1-10-2-5-16(28)13-8-29(7-12(10)13)17-6-15(24)18-20(19(17)23(25,26)27)30(11-3-4-11)9-14(21(18)31)22(32)33/h2,5-6,9-13,16H,3-4,7-8,28H2,1H3,(H,32,33) |
| InChIKey | DQVMMHUJACZIGH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 88.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|