C22H21F4N3O3 — CID 19035228
7-(4-amino-1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-1-cyclopropyl-5-fluoro-4-oxo-8-(trifluoromethyl)quinoline-3-carboxylic acid (PubChem CID 19035228) has the molecular formula C22H21F4N3O3 and a molecular weight of 451.42 g/mol. Its IUPAC name is 7-(4-amino-1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-1-cyclopropyl-5-fluoro-4-oxo-8-(trifluoromethyl)quinoline-3-carboxylic acid.
| Compound Name | 7-(4-amino-1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-1-cyclopropyl-5-fluoro-4-oxo-8-(trifluoromethyl)quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 19035228 |
| Molecular Formula | C22H21F4N3O3 |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 7-(4-amino-1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-1-cyclopropyl-5-fluoro-4-oxo-8-(trifluoromethyl)quinoline-3-carboxylic acid |
| SMILES | NC1C=CCC2CN(c3cc(F)c4c(=O)c(C(=O)O)cn(C5CC5)c4c3C(F)(F)F)CC12 |
| InChI | InChI=1S/C22H21F4N3O3/c23-14-6-16(28-7-10-2-1-3-15(27)12(10)8-28)18(22(24,25)26)19-17(14)20(30)13(21(31)32)9-29(19)11-4-5-11/h1,3,6,9-12,15H,2,4-5,7-8,27H2,(H,31,32) |
| InChIKey | KWNAONIYPRKSDR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 88.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|