C20H21FN4O4 — CID 70208385
[7-[(3aR,4R,7aS)-4-amino-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-1-cyclopropyl-8-fluoro-4-oxo-1,6-naphthyridin-3-yl] hydrogen carbonate (PubChem CID 70208385) has the molecular formula C20H21FN4O4 and a molecular weight of 400.41 g/mol. Its IUPAC name is [7-[(3aR,4R,7aS)-4-amino-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-1-cyclopropyl-8-fluoro-4-oxo-1,6-naphthyridin-3-yl] hydrogen carbonate.
| Compound Name | [7-[(3aR,4R,7aS)-4-amino-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-1-cyclopropyl-8-fluoro-4-oxo-1,6-naphthyridin-3-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 70208385 |
| Molecular Formula | C20H21FN4O4 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | [7-[(3aR,4R,7aS)-4-amino-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-1-cyclopropyl-8-fluoro-4-oxo-1,6-naphthyridin-3-yl] hydrogen carbonate |
| SMILES | N[C@@H]1C=CC[C@@H]2CN(c3ncc4c(=O)c(OC(=O)O)cn(C5CC5)c4c3F)C[C@@H]21 |
| InChI | InChI=1S/C20H21FN4O4/c21-16-17-12(18(26)15(29-20(27)28)9-25(17)11-4-5-11)6-23-19(16)24-7-10-2-1-3-14(22)13(10)8-24/h1,3,6,9-11,13-14H,2,4-5,7-8,22H2,(H,27,28)/t10-,13+,14-/m1/s1 |
| InChIKey | JQPSXMCGXKRWID-DDTOSNHZSA-N |
| XLogP | 2.27 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|