C20H20ClFN4O3 — CID 70208136
7-[(3aR,4R,7aS)-4-amino-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-8-chloro-1-(2-fluorocyclopropyl)-4-oxo-1,6-naphthyridine-3-carboxylic acid (PubChem CID 70208136) has the molecular formula C20H20ClFN4O3 and a molecular weight of 418.86 g/mol. Its IUPAC name is 7-[(3aR,4R,7aS)-4-amino-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-8-chloro-1-(2-fluorocyclopropyl)-4-oxo-1,6-naphthyridine-3-carboxylic acid.
| Compound Name | 7-[(3aR,4R,7aS)-4-amino-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-8-chloro-1-(2-fluorocyclopropyl)-4-oxo-1,6-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 70208136 |
| Molecular Formula | C20H20ClFN4O3 |
| Molecular Weight | 418.86 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 7-[(3aR,4R,7aS)-4-amino-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-8-chloro-1-(2-fluorocyclopropyl)-4-oxo-1,6-naphthyridine-3-carboxylic acid |
| SMILES | N[C@@H]1C=CC[C@@H]2CN(c3ncc4c(=O)c(C(=O)O)cn(C5CC5F)c4c3Cl)C[C@@H]21 |
| InChI | InChI=1S/C20H20ClFN4O3/c21-16-17-10(18(27)12(20(28)29)8-26(17)15-4-13(15)22)5-24-19(16)25-6-9-2-1-3-14(23)11(9)7-25/h1,3,5,8-9,11,13-15H,2,4,6-7,23H2,(H,28,29)/t9-,11+,13?,14-,15?/m1/s1 |
| InChIKey | SOYZGRREAKHYQL-BOOYQRGASA-N |
| XLogP | 2.37 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.86 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|