C21H22ClFN4O3 — CID 70206988
7-[(3aR,4R,7aS)-4-amino-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-8-chloro-1-[(1R,2S)-2-fluorocyclopropyl]-5-methyl-4-oxo-1,6-naphthyridine-3-carboxylic acid (PubChem CID 70206988) has the molecular formula C21H22ClFN4O3 and a molecular weight of 432.88 g/mol. Its IUPAC name is 7-[(3aR,4R,7aS)-4-amino-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-8-chloro-1-[(1R,2S)-2-fluorocyclopropyl]-5-methyl-4-oxo-1,6-naphthyridine-3-carboxylic acid.
| Compound Name | 7-[(3aR,4R,7aS)-4-amino-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-8-chloro-1-[(1R,2S)-2-fluorocyclopropyl]-5-methyl-4-oxo-1,6-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 70206988 |
| Molecular Formula | C21H22ClFN4O3 |
| Molecular Weight | 432.88 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 7-[(3aR,4R,7aS)-4-amino-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-8-chloro-1-[(1R,2S)-2-fluorocyclopropyl]-5-methyl-4-oxo-1,6-naphthyridine-3-carboxylic acid |
| SMILES | Cc1nc(N2C[C@H]3CC=C[C@@H](N)[C@H]3C2)c(Cl)c2c1c(=O)c(C(=O)O)cn2[C@@H]1C[C@@H]1F |
| InChI | InChI=1S/C21H22ClFN4O3/c1-9-16-18(27(15-5-13(15)23)8-12(19(16)28)21(29)30)17(22)20(25-9)26-6-10-3-2-4-14(24)11(10)7-26/h2,4,8,10-11,13-15H,3,5-7,24H2,1H3,(H,29,30)/t10-,11+,13+,14-,15-/m1/s1 |
| InChIKey | GJHOQQXYAXHNHL-ZVJHWVFESA-N |
| XLogP | 2.68 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.88 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|