C23H23F4N3O4 — CID 67690238
[7-(4-amino-7-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-1-cyclopropyl-5-fluoro-4-oxo-8-(trifluoromethyl)quinolin-3-yl] hydrogen carbonate (PubChem CID 67690238) has the molecular formula C23H23F4N3O4 and a molecular weight of 481.45 g/mol. Its IUPAC name is [7-(4-amino-7-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-1-cyclopropyl-5-fluoro-4-oxo-8-(trifluoromethyl)quinolin-3-yl] hydrogen carbonate.
| Compound Name | [7-(4-amino-7-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-1-cyclopropyl-5-fluoro-4-oxo-8-(trifluoromethyl)quinolin-3-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 67690238 |
| Molecular Formula | C23H23F4N3O4 |
| Molecular Weight | 481.45 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | [7-(4-amino-7-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-1-cyclopropyl-5-fluoro-4-oxo-8-(trifluoromethyl)quinolin-3-yl] hydrogen carbonate |
| SMILES | CC1C=CC(N)C2CN(c3cc(F)c4c(=O)c(OC(=O)O)cn(C5CC5)c4c3C(F)(F)F)CC12 |
| InChI | InChI=1S/C23H23F4N3O4/c1-10-2-5-15(28)13-8-29(7-12(10)13)16-6-14(24)18-20(19(16)23(25,26)27)30(11-3-4-11)9-17(21(18)31)34-22(32)33/h2,5-6,9-13,15H,3-4,7-8,28H2,1H3,(H,32,33) |
| InChIKey | UZKAXJQPUQNILU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|