C20H20N2O3S — CID 19041129
2-(3,4-diethoxyphenyl)-4-[6-(oxiran-2-yl)-2-pyridinyl]-1,3-thiazole (PubChem CID 19041129) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is 2-(3,4-diethoxyphenyl)-4-[6-(oxiran-2-yl)-2-pyridinyl]-1,3-thiazole.
| Compound Name | 2-(3,4-diethoxyphenyl)-4-[6-(oxiran-2-yl)-2-pyridinyl]-1,3-thiazole |
|---|---|
| PubChem CID | 19041129 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 2-(3,4-diethoxyphenyl)-4-[6-(oxiran-2-yl)-2-pyridinyl]-1,3-thiazole |
| SMILES | CCOc1ccc(-c2nc(-c3cccc(C4CO4)n3)cs2)cc1OCC |
| InChI | InChI=1S/C20H20N2O3S/c1-3-23-17-9-8-13(10-18(17)24-4-2)20-22-16(12-26-20)14-6-5-7-15(21-14)19-11-25-19/h5-10,12,19H,3-4,11H2,1-2H3 |
| InChIKey | ZRMTUUYQUBIEEV-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 56.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|