C8H11NO3 — CID 19041132
ethyl 3-hydroxy-1,2-dihydropyridine-2-carboxylate (PubChem CID 19041132) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is ethyl 3-hydroxy-1,2-dihydropyridine-2-carboxylate.
| Compound Name | ethyl 3-hydroxy-1,2-dihydropyridine-2-carboxylate |
|---|---|
| PubChem CID | 19041132 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | ethyl 3-hydroxy-1,2-dihydropyridine-2-carboxylate |
| SMILES | CCOC(=O)C1NC=CC=C1O |
| InChI | InChI=1S/C8H11NO3/c1-2-12-8(11)7-6(10)4-3-5-9-7/h3-5,7,9-10H,2H2,1H3 |
| InChIKey | BJIBTSDCXYMEHN-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |