C24H27NO — CID 19049319
3-[(3,5-dimethylphenyl)methoxy]-1,1-diphenylpropan-2-amine (PubChem CID 19049319) has the molecular formula C24H27NO and a molecular weight of 345.49 g/mol. Its IUPAC name is 3-[(3,5-dimethylphenyl)methoxy]-1,1-diphenylpropan-2-amine.
| Compound Name | 3-[(3,5-dimethylphenyl)methoxy]-1,1-diphenylpropan-2-amine |
|---|---|
| PubChem CID | 19049319 |
| Molecular Formula | C24H27NO |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 3-[(3,5-dimethylphenyl)methoxy]-1,1-diphenylpropan-2-amine |
| SMILES | Cc1cc(C)cc(COCC(N)C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C24H27NO/c1-18-13-19(2)15-20(14-18)16-26-17-23(25)24(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-15,23-24H,16-17,25H2,1-2H3 |
| InChIKey | WWBFKWXDEJRSHS-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |