About 3-[(3,5-dimethylphenyl)methoxy]-1,1-diphenylpropan-2-amine
3-[(3,5-dimethylphenyl)methoxy]-1,1-diphenylpropan-2-amine (PubChem CID 19049319) has the molecular formula C24H27NO
and a molecular weight of 345.49 g/mol. Its IUPAC name is 3-[(3,5-dimethylphenyl)methoxy]-1,1-diphenylpropan-2-amine.
Molecular Properties
| Compound Name | 3-[(3,5-dimethylphenyl)methoxy]-1,1-diphenylpropan-2-amine |
| PubChem CID | 19049319 |
| Molecular Formula | C24H27NO |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 3-[(3,5-dimethylphenyl)methoxy]-1,1-diphenylpropan-2-amine |
| SMILES | Cc1cc(C)cc(COCC(N)C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C24H27NO/c1-18-13-19(2)15-20(14-18)16-26-17-23(25)24(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-15,23-24H,16-17,25H2,1-2H3 |
| InChIKey | WWBFKWXDEJRSHS-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(3,5-dimethylphenyl)methoxy]-1,1-diphenylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,5-dimethylphenyl)methoxy]-1,1-diphenylpropan-2-amine?
The IUPAC name of 3-[(3,5-dimethylphenyl)methoxy]-1,1-diphenylpropan-2-amine (CID 19049319) is 3-[(3,5-dimethylphenyl)methoxy]-1,1-diphenylpropan-2-amine.
What is the SMILES notation for 3-[(3,5-dimethylphenyl)methoxy]-1,1-diphenylpropan-2-amine?
The canonical SMILES for 3-[(3,5-dimethylphenyl)methoxy]-1,1-diphenylpropan-2-amine is Cc1cc(C)cc(COCC(N)C(c2ccccc2)c2ccccc2)c1.
What is the InChIKey of 3-[(3,5-dimethylphenyl)methoxy]-1,1-diphenylpropan-2-amine?
The InChIKey is WWBFKWXDEJRSHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27NO/c1-18-13-19(2)15-20(14-18)16-26-17-23(25)24(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-15,23-24H,16-17,25H2,1-2H3.
What are the key properties of 3-[(3,5-dimethylphenyl)methoxy]-1,1-diphenylpropan-2-amine?
3-[(3,5-dimethylphenyl)methoxy]-1,1-diphenylpropan-2-amine has a molecular weight of 345.49 g/mol, XLogP of 4.98, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,5-dimethylphenyl)methoxy]-1,1-diphenylpropan-2-amine is sourced from PubChem (CID 19049319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).