C22H23NO — CID 44299298
1-Benzyloxymethyl-2,2-diphenyl-ethylamine (PubChem CID 44299298) has the molecular formula C22H23NO and a molecular weight of 317.40 g/mol. Its IUPAC name is 1,1-diphenyl-3-phenylmethoxypropan-2-amine.
| Compound Name | 1-Benzyloxymethyl-2,2-diphenyl-ethylamine |
|---|---|
| PubChem CID | 44299298 |
| Molecular Formula | C22H23NO |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | 1,1-diphenyl-3-phenylmethoxypropan-2-amine |
| SMILES | C1=CC=C(C=C1)COCC(C(C2=CC=CC=C2)C3=CC=CC=C3)N |
| InChI | InChI=1S/C22H23NO/c23-21(17-24-16-18-10-4-1-5-11-18)22(19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,21-22H,16-17,23H2 |
| InChIKey | QIPWNEBFOZSRLS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 35.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | 309 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |