C35H42ClNO2Si — CID 19050001
tert-butyl-[4-(3-chloro-5-octoxy-2-pyridinyl)phenoxy]-diphenylsilane (PubChem CID 19050001) has the molecular formula C35H42ClNO2Si and a molecular weight of 572.27 g/mol. Its IUPAC name is tert-butyl-[4-(3-chloro-5-octoxy-2-pyridinyl)phenoxy]-diphenylsilane.
| Compound Name | tert-butyl-[4-(3-chloro-5-octoxy-2-pyridinyl)phenoxy]-diphenylsilane |
|---|---|
| PubChem CID | 19050001 |
| Molecular Formula | C35H42ClNO2Si |
| Molecular Weight | 572.27 g/mol |
| Exact Mass | 571.27 |
| IUPAC Name | tert-butyl-[4-(3-chloro-5-octoxy-2-pyridinyl)phenoxy]-diphenylsilane |
| SMILES | CCCCCCCCOc1cnc(-c2ccc(O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)cc2)c(Cl)c1 |
| InChI | InChI=1S/C35H42ClNO2Si/c1-5-6-7-8-9-16-25-38-30-26-33(36)34(37-27-30)28-21-23-29(24-22-28)39-40(35(2,3)4,31-17-12-10-13-18-31)32-19-14-11-15-20-32/h10-15,17-24,26-27H,5-9,16,25H2,1-4H3 |
| InChIKey | KOCAIDFZWRMCIY-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.27 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|