C41H58N2O3Si — CID 19050334
CID 19050334 (PubChem CID 19050334) has the molecular formula C41H58N2O3Si and a molecular weight of 655.01 g/mol.
| Compound Name | CID 19050334 |
|---|---|
| PubChem CID | 19050334 |
| Molecular Formula | C41H58N2O3Si |
| Molecular Weight | 655.01 g/mol |
| Exact Mass | 654.42 |
| IUPAC Name | — |
| SMILES | CCCCCC(C)CCCCCCC(C)[Si]C1Oc2ccc(-c3ncc(-c4ccc(OCCCCCCC5CC5)cc4)cn3)cc2O1 |
| InChI | InChI=1S/C41H58N2O3Si/c1-4-5-10-15-31(2)16-11-6-7-12-17-32(3)47-41-45-38-26-23-35(28-39(38)46-41)40-42-29-36(30-43-40)34-21-24-37(25-22-34)44-27-14-9-8-13-18-33-19-20-33/h21-26,28-33,41H,4-20,27H2,1-3H3 |
| InChIKey | GYTHRJRHHCQUGP-UHFFFAOYSA-N |
| XLogP | 11.67 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.01 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|