About CID 19050471
CID 19050471 (PubChem CID 19050471) has the molecular formula C36H55NO3Si
and a molecular weight of 577.93 g/mol.
Molecular Properties
| Compound Name | CID 19050471 |
| PubChem CID | 19050471 |
| Molecular Formula | C36H55NO3Si |
| Molecular Weight | 577.93 g/mol |
| Exact Mass | 577.40 |
| IUPAC Name | — |
| SMILES | CCCCCC(C)CCCCCCC(C)[Si]C1Oc2ccc(-c3ccc(OCCCCCCC4CC4)nc3)cc2O1 |
| InChI | InChI=1S/C36H55NO3Si/c1-4-5-10-15-28(2)16-11-6-7-12-17-29(3)41-36-39-33-23-21-31(26-34(33)40-36)32-22-24-35(37-27-32)38-25-14-9-8-13-18-30-19-20-30/h21-24,26-30,36H,4-20,25H2,1-3H3 |
| InChIKey | NARNKJXQNUCHQH-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 577.93 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 19050471 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 19050471?
The IUPAC name of CID 19050471 (CID 19050471) is not available.
What is the SMILES notation for CID 19050471?
The canonical SMILES for CID 19050471 is CCCCCC(C)CCCCCCC(C)[Si]C1Oc2ccc(-c3ccc(OCCCCCCC4CC4)nc3)cc2O1.
What is the InChIKey of CID 19050471?
The InChIKey is NARNKJXQNUCHQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H55NO3Si/c1-4-5-10-15-28(2)16-11-6-7-12-17-29(3)41-36-39-33-23-21-31(26-34(33)40-36)32-22-24-35(37-27-32)38-25-14-9-8-13-18-30-19-20-30/h21-24,26-30,36H,4-20,25H2,1-3H3.
What are the key properties of CID 19050471?
CID 19050471 has a molecular weight of 577.93 g/mol, XLogP of 10.61, 22 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 19050471 is sourced from PubChem (CID 19050471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).