C40H56N2O3Si — CID 19050258
CID 19050258 (PubChem CID 19050258) has the molecular formula C40H56N2O3Si and a molecular weight of 640.99 g/mol.
| Compound Name | CID 19050258 |
|---|---|
| PubChem CID | 19050258 |
| Molecular Formula | C40H56N2O3Si |
| Molecular Weight | 640.99 g/mol |
| Exact Mass | 640.41 |
| IUPAC Name | — |
| SMILES | CCCCC(C)CC(C)CC[Si]Oc1ccccc1-c1cnc(-c2ccc3c(c2)OC(CCCCCCCCCC2CC2)O3)nc1 |
| InChI | InChI=1S/C40H56N2O3Si/c1-4-5-15-30(2)26-31(3)24-25-46-45-36-18-14-13-17-35(36)34-28-41-40(42-29-34)33-22-23-37-38(27-33)44-39(43-37)19-12-10-8-6-7-9-11-16-32-20-21-32/h13-14,17-18,22-23,27-32,39H,4-12,15-16,19-21,24-26H2,1-3H3 |
| InChIKey | XUEZNCHBVCMCGG-UHFFFAOYSA-N |
| XLogP | 11.49 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.99 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|