C39H43F13N2O2Si — CID 19050469
CID 19050469 (PubChem CID 19050469) has the molecular formula C39H43F13N2O2Si and a molecular weight of 846.84 g/mol.
| Compound Name | CID 19050469 |
|---|---|
| PubChem CID | 19050469 |
| Molecular Formula | C39H43F13N2O2Si |
| Molecular Weight | 846.84 g/mol |
| Exact Mass | 846.29 |
| IUPAC Name | — |
| SMILES | CCCCCC(C)CCCCC(C)CC[Si]c1ccccc1-c1cnc(-c2ccc3c(c2)OC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)O3)nc1 |
| InChI | InChI=1S/C39H43F13N2O2Si/c1-4-5-6-11-24(2)12-7-8-13-25(3)18-19-57-31-15-10-9-14-28(31)27-22-53-33(54-23-27)26-16-17-29-30(20-26)56-32(55-29)21-34(40,41)35(42,43)36(44,45)37(46,47)38(48,49)39(50,51)52/h9-10,14-17,20,22-25,32H,4-8,11-13,18-19,21H2,1-3H3 |
| InChIKey | IBQUWZPJTXHBOJ-UHFFFAOYSA-N |
| XLogP | 12.59 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.84 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|