C45H63F3N2OSi — CID 19050285
CID 19050285 (PubChem CID 19050285) has the molecular formula C45H63F3N2OSi and a molecular weight of 733.09 g/mol.
| Compound Name | CID 19050285 |
|---|---|
| PubChem CID | 19050285 |
| Molecular Formula | C45H63F3N2OSi |
| Molecular Weight | 733.09 g/mol |
| Exact Mass | 732.47 |
| IUPAC Name | — |
| SMILES | CCCCCC(C)CCCCC(C)CC[Si]c1ccccc1-c1cnc(-c2ccc3c(c2F)C(F)(F)C(CCCCCCCCCC2CC2)O3)nc1 |
| InChI | InChI=1S/C45H63F3N2OSi/c1-4-5-11-18-33(2)19-14-15-20-34(3)29-30-52-40-23-17-16-22-37(40)36-31-49-44(50-32-36)38-27-28-39-42(43(38)46)45(47,48)41(51-39)24-13-10-8-6-7-9-12-21-35-25-26-35/h16-17,22-23,27-28,31-35,41H,4-15,18-21,24-26,29-30H2,1-3H3 |
| InChIKey | GNRRCIFTFDMYMS-UHFFFAOYSA-N |
| XLogP | 13.27 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.09 |
| LogP ≤ 5 | 13.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|