C33H41F3N2O3 — CID 19050271
5-[4-(4-butoxybutoxy)phenyl]-2-(3,3,4-trifluoro-2-heptyl-2H-1-benzofuran-5-yl)pyrimidine (PubChem CID 19050271) has the molecular formula C33H41F3N2O3 and a molecular weight of 570.70 g/mol. Its IUPAC name is 5-[4-(4-butoxybutoxy)phenyl]-2-(3,3,4-trifluoro-2-heptyl-2H-1-benzofuran-5-yl)pyrimidine.
| Compound Name | 5-[4-(4-butoxybutoxy)phenyl]-2-(3,3,4-trifluoro-2-heptyl-2H-1-benzofuran-5-yl)pyrimidine |
|---|---|
| PubChem CID | 19050271 |
| Molecular Formula | C33H41F3N2O3 |
| Molecular Weight | 570.70 g/mol |
| Exact Mass | 570.31 |
| IUPAC Name | 5-[4-(4-butoxybutoxy)phenyl]-2-(3,3,4-trifluoro-2-heptyl-2H-1-benzofuran-5-yl)pyrimidine |
| SMILES | CCCCCCCC1Oc2ccc(-c3ncc(-c4ccc(OCCCCOCCCC)cc4)cn3)c(F)c2C1(F)F |
| InChI | InChI=1S/C33H41F3N2O3/c1-3-5-7-8-9-12-29-33(35,36)30-28(41-29)18-17-27(31(30)34)32-37-22-25(23-38-32)24-13-15-26(16-14-24)40-21-11-10-20-39-19-6-4-2/h13-18,22-23,29H,3-12,19-21H2,1-2H3 |
| InChIKey | UWTXPZJBBXRHGE-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.70 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|