C35H45F3N2O2 — CID 19050336
5-(4-heptylphenyl)-2-[3,3,4-trifluoro-2-(4-hexoxybutyl)-2H-1-benzofuran-5-yl]pyrimidine (PubChem CID 19050336) has the molecular formula C35H45F3N2O2 and a molecular weight of 582.75 g/mol. Its IUPAC name is 5-(4-heptylphenyl)-2-[3,3,4-trifluoro-2-(4-hexoxybutyl)-2H-1-benzofuran-5-yl]pyrimidine.
| Compound Name | 5-(4-heptylphenyl)-2-[3,3,4-trifluoro-2-(4-hexoxybutyl)-2H-1-benzofuran-5-yl]pyrimidine |
|---|---|
| PubChem CID | 19050336 |
| Molecular Formula | C35H45F3N2O2 |
| Molecular Weight | 582.75 g/mol |
| Exact Mass | 582.34 |
| IUPAC Name | 5-(4-heptylphenyl)-2-[3,3,4-trifluoro-2-(4-hexoxybutyl)-2H-1-benzofuran-5-yl]pyrimidine |
| SMILES | CCCCCCCc1ccc(-c2cnc(-c3ccc4c(c3F)C(F)(F)C(CCCCOCCCCCC)O4)nc2)cc1 |
| InChI | InChI=1S/C35H45F3N2O2/c1-3-5-7-9-10-14-26-16-18-27(19-17-26)28-24-39-34(40-25-28)29-20-21-30-32(33(29)36)35(37,38)31(42-30)15-11-13-23-41-22-12-8-6-4-2/h16-21,24-25,31H,3-15,22-23H2,1-2H3 |
| InChIKey | WVKNOCJMXUVJMU-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.75 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|