C34H42F13NO3Si — CID 137327379
9-methyltetradecan-2-yl-[5-[6-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptoxy)-3-pyridinyl]-1,3-benzodioxol-2-yl]silane (PubChem CID 137327379) has the molecular formula C34H42F13NO3Si and a molecular weight of 787.77 g/mol. Its IUPAC name is 9-methyltetradecan-2-yl-[5-[6-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptoxy)-3-pyridinyl]-1,3-benzodioxol-2-yl]silane.
| Compound Name | 9-methyltetradecan-2-yl-[5-[6-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptoxy)-3-pyridinyl]-1,3-benzodioxol-2-yl]silane |
|---|---|
| PubChem CID | 137327379 |
| Molecular Formula | C34H42F13NO3Si |
| Molecular Weight | 787.77 g/mol |
| Exact Mass | 787.27 |
| IUPAC Name | 9-methyltetradecan-2-yl-[5-[6-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptoxy)-3-pyridinyl]-1,3-benzodioxol-2-yl]silane |
| SMILES | CCCCCC(C)CCCCCCC(C)[SiH2]C1Oc2ccc(-c3ccc(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)nc3)cc2O1 |
| InChI | InChI=1S/C34H42F13NO3Si/c1-4-5-8-11-21(2)12-9-6-7-10-13-22(3)52-28-50-25-16-14-23(18-26(25)51-28)24-15-17-27(48-19-24)49-20-29(35,36)30(37,38)31(39,40)32(41,42)33(43,44)34(45,46)47/h14-19,21-22,28H,4-13,20,52H2,1-3H3 |
| InChIKey | MNUZUEHSKJDJMQ-UHFFFAOYSA-N |
| XLogP | 11.46 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.77 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|