C33H26Cl2N4O3S2 — CID 19050855
N-[(E)-3-[3-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanylanilino]-1-(2,6-dichlorophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19050855) has the molecular formula C33H26Cl2N4O3S2 and a molecular weight of 661.64 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanylanilino]-1-(2,6-dichlorophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanylanilino]-1-(2,6-dichlorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19050855 |
| Molecular Formula | C33H26Cl2N4O3S2 |
| Molecular Weight | 661.64 g/mol |
| Exact Mass | 660.08 |
| IUPAC Name | N-[(E)-3-[3-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanylanilino]-1-(2,6-dichlorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | N#Cc1c(NC(=O)CSc2cccc(NC(=O)/C(=C\c3c(Cl)cccc3Cl)NC(=O)c3ccccc3)c2)sc2c1CCCC2 |
| InChI | InChI=1S/C33H26Cl2N4O3S2/c34-26-13-7-14-27(35)24(26)17-28(38-31(41)20-8-2-1-3-9-20)32(42)37-21-10-6-11-22(16-21)43-19-30(40)39-33-25(18-36)23-12-4-5-15-29(23)44-33/h1-3,6-11,13-14,16-17H,4-5,12,15,19H2,(H,37,42)(H,38,41)(H,39,40)/b28-17+ |
| InChIKey | YDRRZZLAEXTWTD-OGLMXYFKSA-N |
| XLogP | 7.95 |
| TPSA | 111.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.64 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|