C25H28ClN3O5 — CID 19064893
methyl 3-[2-(6-methoxy-2,3,3a,4,5,9b-hexahydro-1H-benzo[g]isoindol-1-yl)ethyl]-2,4-dioxo-1H-quinazoline-7-carboxylate;hydrochloride (PubChem CID 19064893) has the molecular formula C25H28ClN3O5 and a molecular weight of 485.97 g/mol. Its IUPAC name is methyl 3-[2-(6-methoxy-2,3,3a,4,5,9b-hexahydro-1H-benzo[g]isoindol-1-yl)ethyl]-2,4-dioxo-1H-quinazoline-7-carboxylate;hydrochloride.
| Compound Name | methyl 3-[2-(6-methoxy-2,3,3a,4,5,9b-hexahydro-1H-benzo[g]isoindol-1-yl)ethyl]-2,4-dioxo-1H-quinazoline-7-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 19064893 |
| Molecular Formula | C25H28ClN3O5 |
| Molecular Weight | 485.97 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | methyl 3-[2-(6-methoxy-2,3,3a,4,5,9b-hexahydro-1H-benzo[g]isoindol-1-yl)ethyl]-2,4-dioxo-1H-quinazoline-7-carboxylate;hydrochloride |
| SMILES | COC(=O)c1ccc2c(=O)n(CCC3NCC4CCc5c(OC)cccc5C43)c(=O)[nH]c2c1.Cl |
| InChI | InChI=1S/C25H27N3O5.ClH/c1-32-21-5-3-4-17-16(21)8-7-15-13-26-19(22(15)17)10-11-28-23(29)18-9-6-14(24(30)33-2)12-20(18)27-25(28)31;/h3-6,9,12,15,19,22,26H,7-8,10-11,13H2,1-2H3,(H,27,31);1H |
| InChIKey | BDPQDLHDIOCROH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.97 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |