C8H13N3 — CID 19067940
5-cyclohexyl-1H-1,2,4-triazole (PubChem CID 19067940) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 5-cyclohexyl-1H-1,2,4-triazole.
| Compound Name | 5-cyclohexyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 19067940 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 5-cyclohexyl-1H-1,2,4-triazole |
| SMILES | c1n[nH]c(C2CCCCC2)n1 |
| InChI | InChI=1S/C8H13N3/c1-2-4-7(5-3-1)8-9-6-10-11-8/h6-7H,1-5H2,(H,9,10,11) |
| InChIKey | YZYJTQZIVRRSKM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |