C25H30ClFN2O2 — CID 19075037
3-ethyl-1-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-3-methylindol-2-one;hydrochloride (PubChem CID 19075037) has the molecular formula C25H30ClFN2O2 and a molecular weight of 444.98 g/mol. Its IUPAC name is 3-ethyl-1-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-3-methylindol-2-one;hydrochloride.
| Compound Name | 3-ethyl-1-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-3-methylindol-2-one;hydrochloride |
|---|---|
| PubChem CID | 19075037 |
| Molecular Formula | C25H30ClFN2O2 |
| Molecular Weight | 444.98 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 3-ethyl-1-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-3-methylindol-2-one;hydrochloride |
| SMILES | CCC1(C)C(=O)N(CCN2CCC(C(=O)c3ccc(F)cc3)CC2)c2ccccc21.Cl |
| InChI | InChI=1S/C25H29FN2O2.ClH/c1-3-25(2)21-6-4-5-7-22(21)28(24(25)30)17-16-27-14-12-19(13-15-27)23(29)18-8-10-20(26)11-9-18;/h4-11,19H,3,12-17H2,1-2H3;1H |
| InChIKey | ZNLWYQZARTWVCU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.98 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |