C8H8N3S+ — CID 19075418
3-(1-methylpyridin-1-ium-3-yl)-1,2,5-thiadiazole (PubChem CID 19075418) has the molecular formula C8H8N3S+ and a molecular weight of 178.24 g/mol. Its IUPAC name is 3-(1-methylpyridin-1-ium-3-yl)-1,2,5-thiadiazole.
| Compound Name | 3-(1-methylpyridin-1-ium-3-yl)-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 19075418 |
| Molecular Formula | C8H8N3S+ |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | 3-(1-methylpyridin-1-ium-3-yl)-1,2,5-thiadiazole |
| SMILES | C[n+]1cccc(-c2cnsn2)c1 |
| InChI | InChI=1S/C8H8N3S/c1-11-4-2-3-7(6-11)8-5-9-12-10-8/h2-6H,1H3/q+1 |
| InChIKey | QOYOECJRCZDADL-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 29.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|