C20H23Cl2N3O — CID 19076397
5-chloro-3-(2-chlorophenyl)-3-[2-(diethylamino)ethylamino]-1H-indol-2-one (PubChem CID 19076397) has the molecular formula C20H23Cl2N3O and a molecular weight of 392.33 g/mol. Its IUPAC name is 5-chloro-3-(2-chlorophenyl)-3-[2-(diethylamino)ethylamino]-1H-indol-2-one.
| Compound Name | 5-chloro-3-(2-chlorophenyl)-3-[2-(diethylamino)ethylamino]-1H-indol-2-one |
|---|---|
| PubChem CID | 19076397 |
| Molecular Formula | C20H23Cl2N3O |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 5-chloro-3-(2-chlorophenyl)-3-[2-(diethylamino)ethylamino]-1H-indol-2-one |
| SMILES | CCN(CC)CCNC1(c2ccccc2Cl)C(=O)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C20H23Cl2N3O/c1-3-25(4-2)12-11-23-20(15-7-5-6-8-17(15)22)16-13-14(21)9-10-18(16)24-19(20)26/h5-10,13,23H,3-4,11-12H2,1-2H3,(H,24,26) |
| InChIKey | JIUVJIBEGVZYEC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |