C14H22N2O8 — CID 19076854
2-[1,3-diamino-2,2,3-tris(carboxymethyl)cyclohexyl]acetic acid (PubChem CID 19076854) has the molecular formula C14H22N2O8 and a molecular weight of 346.34 g/mol. Its IUPAC name is 2-[1,3-diamino-2,2,3-tris(carboxymethyl)cyclohexyl]acetic acid.
| Compound Name | 2-[1,3-diamino-2,2,3-tris(carboxymethyl)cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 19076854 |
| Molecular Formula | C14H22N2O8 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2-[1,3-diamino-2,2,3-tris(carboxymethyl)cyclohexyl]acetic acid |
| SMILES | NC1(CC(=O)O)CCCC(N)(CC(=O)O)C1(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C14H22N2O8/c15-13(6-10(21)22)2-1-3-14(16,7-11(23)24)12(13,4-8(17)18)5-9(19)20/h1-7,15-16H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | ICPIBAFPHLDTEL-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 201.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |