C10H18N2O4 — CID 57123827
2-[2,2-diamino-1-(carboxymethyl)cyclohexyl]acetic acid (PubChem CID 57123827) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is 2-[2,2-diamino-1-(carboxymethyl)cyclohexyl]acetic acid.
| Compound Name | 2-[2,2-diamino-1-(carboxymethyl)cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 57123827 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 2-[2,2-diamino-1-(carboxymethyl)cyclohexyl]acetic acid |
| SMILES | NC1(N)CCCCC1(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C10H18N2O4/c11-10(12)4-2-1-3-9(10,5-7(13)14)6-8(15)16/h1-6,11-12H2,(H,13,14)(H,15,16) |
| InChIKey | NREVHULJRUUUBG-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|