2-[2,2-diamino-1-(carboxymethyl)cyclohexyl]acetic acid

C10H18N2O4 — CID 57123827

IUPAC2-[2,2-diamino-1-(carboxymethyl)cyclohexyl]acetic acid
SMILESNC1(N)CCCCC1(CC(=O)O)CC(=O)O
InChIInChI=1S/C10H18N2O4/c11-10(12)4-2-1-3-9(10,5-7(13)14)6-8(15)16/h1-6,11-12H2,(H,13,14)(H,15,16)
InChIKeyNREVHULJRUUUBG-UHFFFAOYSA-N
MW230.26 g/mol
LogP0.11
Rot. Bonds4

About 2-[2,2-diamino-1-(carboxymethyl)cyclohexyl]acetic acid

2-[2,2-diamino-1-(carboxymethyl)cyclohexyl]acetic acid (PubChem CID 57123827) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is 2-[2,2-diamino-1-(carboxymethyl)cyclohexyl]acetic acid.

Molecular Properties

Compound Name2-[2,2-diamino-1-(carboxymethyl)cyclohexyl]acetic acid
PubChem CID57123827
Molecular FormulaC10H18N2O4
Molecular Weight230.26 g/mol
Exact Mass230.13
IUPAC Name2-[2,2-diamino-1-(carboxymethyl)cyclohexyl]acetic acid
SMILESNC1(N)CCCCC1(CC(=O)O)CC(=O)O
InChIInChI=1S/C10H18N2O4/c11-10(12)4-2-1-3-9(10,5-7(13)14)6-8(15)16/h1-6,11-12H2,(H,13,14)(H,15,16)
InChIKeyNREVHULJRUUUBG-UHFFFAOYSA-N
XLogP0.11
TPSA126.64 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.26
LogP ≤ 50.11
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 2-[2,2-diamino-1-(carboxymethyl)cyclohexyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2,2-diamino-1-(carboxymethyl)cyclohexyl]acetic acid?
The IUPAC name of 2-[2,2-diamino-1-(carboxymethyl)cyclohexyl]acetic acid (CID 57123827) is 2-[2,2-diamino-1-(carboxymethyl)cyclohexyl]acetic acid.
What is the SMILES notation for 2-[2,2-diamino-1-(carboxymethyl)cyclohexyl]acetic acid?
The canonical SMILES for 2-[2,2-diamino-1-(carboxymethyl)cyclohexyl]acetic acid is NC1(N)CCCCC1(CC(=O)O)CC(=O)O.
What is the InChIKey of 2-[2,2-diamino-1-(carboxymethyl)cyclohexyl]acetic acid?
The InChIKey is NREVHULJRUUUBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O4/c11-10(12)4-2-1-3-9(10,5-7(13)14)6-8(15)16/h1-6,11-12H2,(H,13,14)(H,15,16).
What are the key properties of 2-[2,2-diamino-1-(carboxymethyl)cyclohexyl]acetic acid?
2-[2,2-diamino-1-(carboxymethyl)cyclohexyl]acetic acid has a molecular weight of 230.26 g/mol, XLogP of 0.11, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-diamino-1-(carboxymethyl)cyclohexyl]acetic acid is sourced from PubChem (CID 57123827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).