C22H29ClN2O4 — CID 19081840
1-[4-amino-5-chloro-2-[(3,5-dimethoxyphenyl)methoxy]phenyl]-5-(dimethylamino)pentan-1-one (PubChem CID 19081840) has the molecular formula C22H29ClN2O4 and a molecular weight of 420.94 g/mol. Its IUPAC name is 1-[4-amino-5-chloro-2-[(3,5-dimethoxyphenyl)methoxy]phenyl]-5-(dimethylamino)pentan-1-one.
| Compound Name | 1-[4-amino-5-chloro-2-[(3,5-dimethoxyphenyl)methoxy]phenyl]-5-(dimethylamino)pentan-1-one |
|---|---|
| PubChem CID | 19081840 |
| Molecular Formula | C22H29ClN2O4 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 1-[4-amino-5-chloro-2-[(3,5-dimethoxyphenyl)methoxy]phenyl]-5-(dimethylamino)pentan-1-one |
| SMILES | COc1cc(COc2cc(N)c(Cl)cc2C(=O)CCCCN(C)C)cc(OC)c1 |
| InChI | InChI=1S/C22H29ClN2O4/c1-25(2)8-6-5-7-21(26)18-12-19(23)20(24)13-22(18)29-14-15-9-16(27-3)11-17(10-15)28-4/h9-13H,5-8,14,24H2,1-4H3 |
| InChIKey | PHIDDUVSNZFBED-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|