C26H35Cl2N3O5 — CID 19081946
1-[5-[4-amino-5-chloro-2-[(3,5-dimethoxyphenyl)methoxy]phenyl]-5-oxopentyl]piperidine-4-carboxamide;hydrochloride (PubChem CID 19081946) has the molecular formula C26H35Cl2N3O5 and a molecular weight of 540.49 g/mol. Its IUPAC name is 1-[5-[4-amino-5-chloro-2-[(3,5-dimethoxyphenyl)methoxy]phenyl]-5-oxopentyl]piperidine-4-carboxamide;hydrochloride.
| Compound Name | 1-[5-[4-amino-5-chloro-2-[(3,5-dimethoxyphenyl)methoxy]phenyl]-5-oxopentyl]piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 19081946 |
| Molecular Formula | C26H35Cl2N3O5 |
| Molecular Weight | 540.49 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | 1-[5-[4-amino-5-chloro-2-[(3,5-dimethoxyphenyl)methoxy]phenyl]-5-oxopentyl]piperidine-4-carboxamide;hydrochloride |
| SMILES | COc1cc(COc2cc(N)c(Cl)cc2C(=O)CCCCN2CCC(C(N)=O)CC2)cc(OC)c1.Cl |
| InChI | InChI=1S/C26H34ClN3O5.ClH/c1-33-19-11-17(12-20(13-19)34-2)16-35-25-15-23(28)22(27)14-21(25)24(31)5-3-4-8-30-9-6-18(7-10-30)26(29)32;/h11-15,18H,3-10,16,28H2,1-2H3,(H2,29,32);1H |
| InChIKey | ADLQGQWAOIDXEJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 117.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|