C7H8BrClF2O4 — CID 19082448
2-(2-bromo-4-chloro-4,4-difluorobutyl)propanedioic acid (PubChem CID 19082448) has the molecular formula C7H8BrClF2O4 and a molecular weight of 309.49 g/mol. Its IUPAC name is 2-(2-bromo-4-chloro-4,4-difluorobutyl)propanedioic acid.
| Compound Name | 2-(2-bromo-4-chloro-4,4-difluorobutyl)propanedioic acid |
|---|---|
| PubChem CID | 19082448 |
| Molecular Formula | C7H8BrClF2O4 |
| Molecular Weight | 309.49 g/mol |
| Exact Mass | 307.93 |
| IUPAC Name | 2-(2-bromo-4-chloro-4,4-difluorobutyl)propanedioic acid |
| SMILES | O=C(O)C(CC(Br)CC(F)(F)Cl)C(=O)O |
| InChI | InChI=1S/C7H8BrClF2O4/c8-3(2-7(9,10)11)1-4(5(12)13)6(14)15/h3-4H,1-2H2,(H,12,13)(H,14,15) |
| InChIKey | IRZKGSOLMYRLPA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.49 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|