C8H7F6N3 — CID 19102264
N,N-bis(trifluoromethylamino)aniline (PubChem CID 19102264) has the molecular formula C8H7F6N3 and a molecular weight of 259.15 g/mol. Its IUPAC name is N,N-bis(trifluoromethylamino)aniline.
| Compound Name | N,N-bis(trifluoromethylamino)aniline |
|---|---|
| PubChem CID | 19102264 |
| Molecular Formula | C8H7F6N3 |
| Molecular Weight | 259.15 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | N,N-bis(trifluoromethylamino)aniline |
| SMILES | FC(F)(F)NN(NC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C8H7F6N3/c9-7(10,11)15-17(16-8(12,13)14)6-4-2-1-3-5-6/h1-5,15-16H |
| InChIKey | NAVTYHLLSNYZAS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.15 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|