C5H3N5O2 — CID 19108230
5-nitrotetrazolo[1,5-a]pyridine (PubChem CID 19108230) has the molecular formula C5H3N5O2 and a molecular weight of 165.11 g/mol. Its IUPAC name is 5-nitrotetrazolo[1,5-a]pyridine.
| Compound Name | 5-nitrotetrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 19108230 |
| Molecular Formula | C5H3N5O2 |
| Molecular Weight | 165.11 g/mol |
| Exact Mass | 165.03 |
| IUPAC Name | 5-nitrotetrazolo[1,5-a]pyridine |
| SMILES | O=[N+]([O-])c1cccc2nnnn12 |
| InChI | InChI=1S/C5H3N5O2/c11-10(12)5-3-1-2-4-6-7-8-9(4)5/h1-3H |
| InChIKey | QGDWDFYLKGUBEY-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 86.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.11 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|