C21H17N3O5S2 — CID 19115062
6-hydroxy-5-[2-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]-1,4-dimethyl-2-oxopyridine-3-carbonitrile (PubChem CID 19115062) has the molecular formula C21H17N3O5S2 and a molecular weight of 455.52 g/mol. Its IUPAC name is 6-hydroxy-5-[2-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]-1,4-dimethyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 6-hydroxy-5-[2-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]-1,4-dimethyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19115062 |
| Molecular Formula | C21H17N3O5S2 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | 6-hydroxy-5-[2-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]-1,4-dimethyl-2-oxopyridine-3-carbonitrile |
| SMILES | COc1ccc(/C=C2\SC(=S)N(CC(=O)c3c(C)c(C#N)c(=O)n(C)c3O)C2=O)cc1 |
| InChI | InChI=1S/C21H17N3O5S2/c1-11-14(9-22)18(26)23(2)20(28)17(11)15(25)10-24-19(27)16(31-21(24)30)8-12-4-6-13(29-3)7-5-12/h4-8,28H,10H2,1-3H3/b16-8- |
| InChIKey | UHMSLKPTFMUUNH-PXNMLYILSA-N |
| XLogP | 2.36 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|