C22H19N3O4S2 — CID 19115057
6-hydroxy-1,4-dimethyl-5-[3-[(5Z)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]-2-oxopyridine-3-carbonitrile (PubChem CID 19115057) has the molecular formula C22H19N3O4S2 and a molecular weight of 453.55 g/mol. Its IUPAC name is 6-hydroxy-1,4-dimethyl-5-[3-[(5Z)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]-2-oxopyridine-3-carbonitrile.
| Compound Name | 6-hydroxy-1,4-dimethyl-5-[3-[(5Z)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19115057 |
| Molecular Formula | C22H19N3O4S2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 6-hydroxy-1,4-dimethyl-5-[3-[(5Z)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]-2-oxopyridine-3-carbonitrile |
| SMILES | Cc1ccc(/C=C2\SC(=S)N(CCC(=O)c3c(C)c(C#N)c(=O)n(C)c3O)C2=O)cc1 |
| InChI | InChI=1S/C22H19N3O4S2/c1-12-4-6-14(7-5-12)10-17-20(28)25(22(30)31-17)9-8-16(26)18-13(2)15(11-23)19(27)24(3)21(18)29/h4-7,10,29H,8-9H2,1-3H3/b17-10- |
| InChIKey | LLBPBCORGUYVEP-YVLHZVERSA-N |
| XLogP | 3.05 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|