C28H22FN3O4S2 — CID 19116929
5-[3-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]-6-hydroxy-4-methyl-2-oxo-1-(2-phenylethyl)pyridine-3-carbonitrile (PubChem CID 19116929) has the molecular formula C28H22FN3O4S2 and a molecular weight of 547.63 g/mol. Its IUPAC name is 5-[3-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]-6-hydroxy-4-methyl-2-oxo-1-(2-phenylethyl)pyridine-3-carbonitrile.
| Compound Name | 5-[3-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]-6-hydroxy-4-methyl-2-oxo-1-(2-phenylethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19116929 |
| Molecular Formula | C28H22FN3O4S2 |
| Molecular Weight | 547.63 g/mol |
| Exact Mass | 547.10 |
| IUPAC Name | 5-[3-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]-6-hydroxy-4-methyl-2-oxo-1-(2-phenylethyl)pyridine-3-carbonitrile |
| SMILES | Cc1c(C(=O)CCN2C(=O)/C(=C/c3ccc(F)cc3)SC2=S)c(O)n(CCc2ccccc2)c(=O)c1C#N |
| InChI | InChI=1S/C28H22FN3O4S2/c1-17-21(16-30)25(34)31(13-11-18-5-3-2-4-6-18)27(36)24(17)22(33)12-14-32-26(35)23(38-28(32)37)15-19-7-9-20(29)10-8-19/h2-10,15,36H,11-14H2,1H3/b23-15- |
| InChIKey | GYLSLVZNTNFMGL-HAHDFKILSA-N |
| XLogP | 4.59 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.63 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|