C30H27N3O5S2 — CID 19118130
5-[4-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoyl]-6-hydroxy-1-[2-(4-methoxyphenyl)ethyl]-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 19118130) has the molecular formula C30H27N3O5S2 and a molecular weight of 573.70 g/mol. Its IUPAC name is 5-[4-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoyl]-6-hydroxy-1-[2-(4-methoxyphenyl)ethyl]-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 5-[4-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoyl]-6-hydroxy-1-[2-(4-methoxyphenyl)ethyl]-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19118130 |
| Molecular Formula | C30H27N3O5S2 |
| Molecular Weight | 573.70 g/mol |
| Exact Mass | 573.14 |
| IUPAC Name | 5-[4-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoyl]-6-hydroxy-1-[2-(4-methoxyphenyl)ethyl]-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | COc1ccc(CCn2c(O)c(C(=O)CCCN3C(=O)/C(=C/c4ccccc4)SC3=S)c(C)c(C#N)c2=O)cc1 |
| InChI | InChI=1S/C30H27N3O5S2/c1-19-23(18-31)27(35)32(16-14-20-10-12-22(38-2)13-11-20)29(37)26(19)24(34)9-6-15-33-28(36)25(40-30(33)39)17-21-7-4-3-5-8-21/h3-5,7-8,10-13,17,37H,6,9,14-16H2,1-2H3/b25-17- |
| InChIKey | WJGDQOFIIKXROP-UQQQWYQISA-N |
| XLogP | 4.85 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.70 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|