C26H27N3O5S2 — CID 19118806
1-hexyl-6-hydroxy-5-[2-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 19118806) has the molecular formula C26H27N3O5S2 and a molecular weight of 525.65 g/mol. Its IUPAC name is 1-hexyl-6-hydroxy-5-[2-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-hexyl-6-hydroxy-5-[2-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19118806 |
| Molecular Formula | C26H27N3O5S2 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | 1-hexyl-6-hydroxy-5-[2-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCCCn1c(O)c(C(=O)CN2C(=O)/C(=C/c3ccc(OC)cc3)SC2=S)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C26H27N3O5S2/c1-4-5-6-7-12-28-23(31)19(14-27)16(2)22(25(28)33)20(30)15-29-24(32)21(36-26(29)35)13-17-8-10-18(34-3)11-9-17/h8-11,13,33H,4-7,12,15H2,1-3H3/b21-13- |
| InChIKey | ZYKPGZHWKFNYJM-BKUYFWCQSA-N |
| XLogP | 4.41 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|