C24H22FN3O5S2 — CID 19117197
5-[3-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]-6-hydroxy-1-(3-methoxypropyl)-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 19117197) has the molecular formula C24H22FN3O5S2 and a molecular weight of 515.59 g/mol. Its IUPAC name is 5-[3-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]-6-hydroxy-1-(3-methoxypropyl)-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 5-[3-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]-6-hydroxy-1-(3-methoxypropyl)-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19117197 |
| Molecular Formula | C24H22FN3O5S2 |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.10 |
| IUPAC Name | 5-[3-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]-6-hydroxy-1-(3-methoxypropyl)-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | COCCCn1c(O)c(C(=O)CCN2C(=O)/C(=C/c3ccc(F)cc3)SC2=S)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C24H22FN3O5S2/c1-14-17(13-26)21(30)27(9-3-11-33-2)23(32)20(14)18(29)8-10-28-22(31)19(35-24(28)34)12-15-4-6-16(25)7-5-15/h4-7,12,32H,3,8-11H2,1-2H3/b19-12- |
| InChIKey | FOECAOYKVFXEFI-UNOMPAQXSA-N |
| XLogP | 3.38 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|