C25H25N3O4S2 — CID 19115585
5-[3-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]-6-hydroxy-4-methyl-2-oxo-1-pentylpyridine-3-carbonitrile (PubChem CID 19115585) has the molecular formula C25H25N3O4S2 and a molecular weight of 495.63 g/mol. Its IUPAC name is 5-[3-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]-6-hydroxy-4-methyl-2-oxo-1-pentylpyridine-3-carbonitrile.
| Compound Name | 5-[3-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]-6-hydroxy-4-methyl-2-oxo-1-pentylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19115585 |
| Molecular Formula | C25H25N3O4S2 |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | 5-[3-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]-6-hydroxy-4-methyl-2-oxo-1-pentylpyridine-3-carbonitrile |
| SMILES | CCCCCn1c(O)c(C(=O)CCN2C(=O)/C(=C/c3ccccc3)SC2=S)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C25H25N3O4S2/c1-3-4-8-12-27-22(30)18(15-26)16(2)21(24(27)32)19(29)11-13-28-23(31)20(34-25(28)33)14-17-9-6-5-7-10-17/h5-7,9-10,14,32H,3-4,8,11-13H2,1-2H3/b20-14- |
| InChIKey | ZYALGKQHQPZWIV-ZHZULCJRSA-N |
| XLogP | 4.40 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|