C20H21FN2O4 — CID 19115387
1-butyl-5-[2-(4-fluorophenoxy)propanoyl]-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 19115387) has the molecular formula C20H21FN2O4 and a molecular weight of 372.40 g/mol. Its IUPAC name is 1-butyl-5-[2-(4-fluorophenoxy)propanoyl]-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-butyl-5-[2-(4-fluorophenoxy)propanoyl]-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19115387 |
| Molecular Formula | C20H21FN2O4 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 1-butyl-5-[2-(4-fluorophenoxy)propanoyl]-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCn1c(O)c(C(=O)C(C)Oc2ccc(F)cc2)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C20H21FN2O4/c1-4-5-10-23-19(25)16(11-22)12(2)17(20(23)26)18(24)13(3)27-15-8-6-14(21)7-9-15/h6-9,13,26H,4-5,10H2,1-3H3 |
| InChIKey | OUJJFPGPPOQXOZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |