C26H21N3O4S3 — CID 19116787
1-benzyl-6-hydroxy-4-methyl-2-oxo-5-[4-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]butanoyl]pyridine-3-carbonitrile (PubChem CID 19116787) has the molecular formula C26H21N3O4S3 and a molecular weight of 535.67 g/mol. Its IUPAC name is 1-benzyl-6-hydroxy-4-methyl-2-oxo-5-[4-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]butanoyl]pyridine-3-carbonitrile.
| Compound Name | 1-benzyl-6-hydroxy-4-methyl-2-oxo-5-[4-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]butanoyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19116787 |
| Molecular Formula | C26H21N3O4S3 |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.07 |
| IUPAC Name | 1-benzyl-6-hydroxy-4-methyl-2-oxo-5-[4-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]butanoyl]pyridine-3-carbonitrile |
| SMILES | Cc1c(C(=O)CCCN2C(=O)/C(=C/c3cccs3)SC2=S)c(O)n(Cc2ccccc2)c(=O)c1C#N |
| InChI | InChI=1S/C26H21N3O4S3/c1-16-19(14-27)23(31)29(15-17-7-3-2-4-8-17)25(33)22(16)20(30)10-5-11-28-24(32)21(36-26(28)34)13-18-9-6-12-35-18/h2-4,6-9,12-13,33H,5,10-11,15H2,1H3/b21-13- |
| InChIKey | WOJNXLATXBQATK-BKUYFWCQSA-N |
| XLogP | 4.71 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|