C29H25BrN2O3 — CID 19121696
[2-amino-4-(3-bromophenyl)-3-cyano-4H-chromen-7-yl] (E)-3-(4-tert-butylphenyl)prop-2-enoate (PubChem CID 19121696) has the molecular formula C29H25BrN2O3 and a molecular weight of 529.43 g/mol. Its IUPAC name is [2-amino-4-(3-bromophenyl)-3-cyano-4H-chromen-7-yl] (E)-3-(4-tert-butylphenyl)prop-2-enoate.
| Compound Name | [2-amino-4-(3-bromophenyl)-3-cyano-4H-chromen-7-yl] (E)-3-(4-tert-butylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19121696 |
| Molecular Formula | C29H25BrN2O3 |
| Molecular Weight | 529.43 g/mol |
| Exact Mass | 528.10 |
| IUPAC Name | [2-amino-4-(3-bromophenyl)-3-cyano-4H-chromen-7-yl] (E)-3-(4-tert-butylphenyl)prop-2-enoate |
| SMILES | CC(C)(C)c1ccc(/C=C/C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C29H25BrN2O3/c1-29(2,3)20-10-7-18(8-11-20)9-14-26(33)34-22-12-13-23-25(16-22)35-28(32)24(17-31)27(23)19-5-4-6-21(30)15-19/h4-16,27H,32H2,1-3H3/b14-9+ |
| InChIKey | BQBAGDYGFLGBNE-NTEUORMPSA-N |
| XLogP | 6.58 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.43 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|