C33H28N2O3 — CID 19122574
(2-amino-3-cyano-4-naphthalen-1-yl-4H-chromen-7-yl) (E)-3-(4-tert-butylphenyl)prop-2-enoate (PubChem CID 19122574) has the molecular formula C33H28N2O3 and a molecular weight of 500.60 g/mol. Its IUPAC name is (2-amino-3-cyano-4-naphthalen-1-yl-4H-chromen-7-yl) (E)-3-(4-tert-butylphenyl)prop-2-enoate.
| Compound Name | (2-amino-3-cyano-4-naphthalen-1-yl-4H-chromen-7-yl) (E)-3-(4-tert-butylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19122574 |
| Molecular Formula | C33H28N2O3 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | (2-amino-3-cyano-4-naphthalen-1-yl-4H-chromen-7-yl) (E)-3-(4-tert-butylphenyl)prop-2-enoate |
| SMILES | CC(C)(C)c1ccc(/C=C/C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C33H28N2O3/c1-33(2,3)23-14-11-21(12-15-23)13-18-30(36)37-24-16-17-27-29(19-24)38-32(35)28(20-34)31(27)26-10-6-8-22-7-4-5-9-25(22)26/h4-19,31H,35H2,1-3H3/b18-13+ |
| InChIKey | BHCWRRVMXAERPR-QGOAFFKASA-N |
| XLogP | 6.97 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|