C24H16BrN3O6 — CID 19121996
[2-amino-3-cyano-4-(3-nitrophenyl)-4H-chromen-7-yl] 2-(4-bromophenoxy)acetate (PubChem CID 19121996) has the molecular formula C24H16BrN3O6 and a molecular weight of 522.31 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-nitrophenyl)-4H-chromen-7-yl] 2-(4-bromophenoxy)acetate.
| Compound Name | [2-amino-3-cyano-4-(3-nitrophenyl)-4H-chromen-7-yl] 2-(4-bromophenoxy)acetate |
|---|---|
| PubChem CID | 19121996 |
| Molecular Formula | C24H16BrN3O6 |
| Molecular Weight | 522.31 g/mol |
| Exact Mass | 521.02 |
| IUPAC Name | [2-amino-3-cyano-4-(3-nitrophenyl)-4H-chromen-7-yl] 2-(4-bromophenoxy)acetate |
| SMILES | N#CC1=C(N)Oc2cc(OC(=O)COc3ccc(Br)cc3)ccc2C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H16BrN3O6/c25-15-4-6-17(7-5-15)32-13-22(29)33-18-8-9-19-21(11-18)34-24(27)20(12-26)23(19)14-2-1-3-16(10-14)28(30)31/h1-11,23H,13,27H2 |
| InChIKey | ICAPZVAXBSSRSH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 137.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.31 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|