C27H23BrN2O5 — CID 19123557
[2-amino-4-(5-bromo-2-methoxyphenyl)-3-cyano-4H-chromen-7-yl] 2-(2,3-dimethylphenoxy)acetate (PubChem CID 19123557) has the molecular formula C27H23BrN2O5 and a molecular weight of 535.39 g/mol. Its IUPAC name is [2-amino-4-(5-bromo-2-methoxyphenyl)-3-cyano-4H-chromen-7-yl] 2-(2,3-dimethylphenoxy)acetate.
| Compound Name | [2-amino-4-(5-bromo-2-methoxyphenyl)-3-cyano-4H-chromen-7-yl] 2-(2,3-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 19123557 |
| Molecular Formula | C27H23BrN2O5 |
| Molecular Weight | 535.39 g/mol |
| Exact Mass | 534.08 |
| IUPAC Name | [2-amino-4-(5-bromo-2-methoxyphenyl)-3-cyano-4H-chromen-7-yl] 2-(2,3-dimethylphenoxy)acetate |
| SMILES | COc1ccc(Br)cc1C1C(C#N)=C(N)Oc2cc(OC(=O)COc3cccc(C)c3C)ccc21 |
| InChI | InChI=1S/C27H23BrN2O5/c1-15-5-4-6-22(16(15)2)33-14-25(31)34-18-8-9-19-24(12-18)35-27(30)21(13-29)26(19)20-11-17(28)7-10-23(20)32-3/h4-12,26H,14,30H2,1-3H3 |
| InChIKey | ZMQDPHRZCKGIKT-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.39 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|