C28H21N3O6 — CID 19128331
[2-amino-3-cyano-4-(3-nitrophenyl)-4H-chromen-7-yl] 5-ethyl-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 19128331) has the molecular formula C28H21N3O6 and a molecular weight of 495.49 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-nitrophenyl)-4H-chromen-7-yl] 5-ethyl-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-(3-nitrophenyl)-4H-chromen-7-yl] 5-ethyl-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19128331 |
| Molecular Formula | C28H21N3O6 |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | [2-amino-3-cyano-4-(3-nitrophenyl)-4H-chromen-7-yl] 5-ethyl-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | CCc1ccc2oc(C(=O)Oc3ccc4c(c3)OC(N)=C(C#N)C4c3cccc([N+](=O)[O-])c3)c(C)c2c1 |
| InChI | InChI=1S/C28H21N3O6/c1-3-16-7-10-23-21(11-16)15(2)26(36-23)28(32)35-19-8-9-20-24(13-19)37-27(30)22(14-29)25(20)17-5-4-6-18(12-17)31(33)34/h4-13,25H,3,30H2,1-2H3 |
| InChIKey | RWMOMXYRRMTBHC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 141.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|