C22H18ClN5S — CID 19136570
4-(4-chlorophenyl)sulfanyl-6-(2,2-diphenylhydrazinyl)pyrimidin-5-amine (PubChem CID 19136570) has the molecular formula C22H18ClN5S and a molecular weight of 419.94 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-6-(2,2-diphenylhydrazinyl)pyrimidin-5-amine.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-6-(2,2-diphenylhydrazinyl)pyrimidin-5-amine |
|---|---|
| PubChem CID | 19136570 |
| Molecular Formula | C22H18ClN5S |
| Molecular Weight | 419.94 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-6-(2,2-diphenylhydrazinyl)pyrimidin-5-amine |
| SMILES | Nc1c(NN(c2ccccc2)c2ccccc2)ncnc1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H18ClN5S/c23-16-11-13-19(14-12-16)29-22-20(24)21(25-15-26-22)27-28(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-15H,24H2,(H,25,26,27) |
| InChIKey | KPUIKQTXCBORGZ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.94 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|